EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16OSn |
| Net Charge | 0 |
| Average Mass | 367.036 |
| Monoisotopic Mass | 368.02231 |
| SMILES | [OH][Sn]([c]1ccccc1)([c]1ccccc1)[c]1ccccc1 |
| InChI | InChI=1S/3C6H5.H2O.Sn/c3*1-2-4-6-5-3-1;;/h3*1-5H;1H2;/q;;;;+1/p-1 |
| InChIKey | BFWMWWXRWVJXSE-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fentin hydroxide (CHEBI:30473) has functional parent triphenylstannane (CHEBI:30537) |
| fentin hydroxide (CHEBI:30473) has role acaricide (CHEBI:22153) |
| fentin hydroxide (CHEBI:30473) has role antifungal agrochemical (CHEBI:86328) |
| fentin hydroxide (CHEBI:30473) is a hydroxides (CHEBI:24651) |
| fentin hydroxide (CHEBI:30473) is a organotin compound (CHEBI:25717) |
| Incoming Relation(s) |
| fentin acetate (CHEBI:81918) has functional parent fentin hydroxide (CHEBI:30473) |
| IUPAC Name |
|---|
| triphenylstannanol |
| Synonyms | Source |
|---|---|
| Sn(OH)Ph3 | IUPAC |
| [Sn(OH)Ph3] | MolBase |
| triphenyltin hydroxide | ChemIDplus |
| hydroxytriphenyltin | NIST Chemistry WebBook |
| hydroxytriphenylstannane | NIST Chemistry WebBook |
| Fentin | KEGG COMPOUND |
| Citations |
|---|