EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O3Te |
| Net Charge | 0 |
| Average Mass | 177.613 |
| Monoisotopic Mass | 179.90662 |
| SMILES | [H]O[Te]([H])(=O)=O |
| InChI | InChI=1S/H2O3Te/c1-4(2)3/h4H,(H,1,2,3) |
| InChIKey | NPTIASHZBHWDSH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| telluronic acid (CHEBI:30466) is a tellurium oxoacid (CHEBI:33519) |
| IUPAC Names |
|---|
| hydridohydroxidodioxidotellurium |
| telluronic acid |
| Synonyms | Source |
|---|---|
| HTeHO3 | IUPAC |
| [TeHO2(OH)] | IUPAC |
| Telluronsäure | ChEBI |