EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H12Sn |
| Net Charge | 0 |
| Average Mass | 178.851 |
| Monoisotopic Mass | 179.99610 |
| SMILES | [CH3][Sn]([CH3])([CH3])[CH3] |
| InChI | InChI=1S/4CH3.Sn/h4*1H3; |
| InChIKey | VXKWYPOMXBVZSJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| Application: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetramethyltin (CHEBI:30420) has role NMR chemical shift reference compound (CHEBI:228364) |
| tetramethyltin (CHEBI:30420) is a organotin compound (CHEBI:25717) |
| IUPAC Names |
|---|
| tetramethylstannane |
| tetramethyltin |
| Synonyms | Source |
|---|---|
| (CH3)4Sn | NIST Chemistry WebBook |
| [SnMe4] | MolBase |
| SnMe4 | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 817 | MolBase |
| Tetramethyltin | Wikipedia |
| US4216066 | Patent |
| Citations |
|---|