EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H3OS |
| Net Charge | -1 |
| Average Mass | 75.112 |
| Monoisotopic Mass | 74.99101 |
| SMILES | CC(=O)[S-] |
| InChI | InChI=1S/C2H4OS/c1-2(3)4/h1H3,(H,3,4)/p-1 |
| InChIKey | DUYAAUVXQSMXQP-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thioacetate (CHEBI:30320) is a thiocarboxylic acid anion (CHEBI:35367) |
| thioacetate (CHEBI:30320) is conjugate base of thioacetic acid (CHEBI:26952) |
| Incoming Relation(s) |
| thioacetic acid (CHEBI:26952) is conjugate acid of thioacetate (CHEBI:30320) |
| IUPAC Names |
|---|
| thioacetate |
| ethanethioate |
| Synonym | Source |
|---|---|
| Thioacetat | ChEBI |
| UniProt Name | Source |
|---|---|
| thioacetate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3903387 | Beilstein |
| Gmelin:323277 | Gmelin |
| Beilstein:1848542 | Beilstein |
| CAS:29632-72-2 | ChemIDplus |