EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N4O3 |
| Net Charge | 0 |
| Average Mass | 240.263 |
| Monoisotopic Mass | 240.12224 |
| SMILES | N[C@@H](CCC(=O)NCCc1cncn1)C(=O)O |
| InChI | InChI=1S/C10H16N4O3/c11-8(10(16)17)1-2-9(15)13-4-3-7-5-12-6-14-7/h5-6,8H,1-4,11H2,(H,12,14)(H,13,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | BGNAGOFSEBNIJN-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nα-γ-L-glutamylhistamine (CHEBI:30307) has functional parent histamine (CHEBI:18295) |
| Nα-γ-L-glutamylhistamine (CHEBI:30307) is a glutamyl-L-amino acid (CHEBI:24323) |
| Nα-γ-L-glutamylhistamine (CHEBI:30307) is tautomer of Nα-γ-L-glutamylhistamine zwitterion (CHEBI:58631) |
| Incoming Relation(s) |
| N-[2-(1H-imidazol-4-yl)ethyl]-L-glutamine residue (CHEBI:167179) is substituent group from Nα-γ-L-glutamylhistamine (CHEBI:30307) |
| Nα-γ-L-glutamylhistamine zwitterion (CHEBI:58631) is tautomer of Nα-γ-L-glutamylhistamine (CHEBI:30307) |
| IUPAC Name |
|---|
| N-[2-(1H-imidazol-4-yl)ethyl]-L-glutamine |
| Synonyms | Source |
|---|---|
| N(alpha)-gamma-L-glutamylhistamine | ChEBI |
| N(alpha)-gamma-L-Glutamylhistamine | KEGG COMPOUND |
| N5-[2-(1H-imidazol-4-yl)ethyl]-L-glutamine | IUPAC |
| Nα-(L-glutam-5-yl)histamine | ChEBI |
| Nalpha-gamma-L-glutamylhistamine | KEGG COMPOUND |