EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H3O3Sb |
| Net Charge | 0 |
| Average Mass | 172.781 |
| Monoisotopic Mass | 171.91203 |
| SMILES | [H][O][Sb]([H])(=[O])[O][H] |
| InChI | InChI=1S/2H2O.O.Sb.H/h2*1H2;;;/q;;;+2;/p-2 |
| InChIKey | WXJFXEYOZNYMMJ-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stibonic acid (CHEBI:30298) is a antimony oxoacid (CHEBI:36920) |
| IUPAC Names |
|---|
| hydridodihydroxidooxidoantimony |
| stibonic acid |
| Synonyms | Source |
|---|---|
| H2SbHO3 | IUPAC |
| [SbHO(OH)2] | IUPAC |