EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:30294 - antimonic acid
| Formula | H3O4Sb |
| Net Charge | 0 |
| Average Mass | 188.780 |
| Monoisotopic Mass | 187.90695 |
| SMILES | [H][O][Sb](=[O])([O][H])[O][H] |
| InChI | InChI=1S/3H2O.O.Sb/h3*1H2;;/q;;;;+3/p-3 |
| InChIKey | AQTIRDJOWSATJB-UHFFFAOYSA-K |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| antimonic acid (CHEBI:30294) is a antimony oxoacid (CHEBI:36920) |
| antimonic acid (CHEBI:30294) is conjugate acid of antimonate(1−) (CHEBI:36923) |
| Incoming Relation(s) |
| antimonate(1−) (CHEBI:36923) is conjugate base of antimonic acid (CHEBI:30294) |
| stiboryl group (CHEBI:48439) is substituent group from antimonic acid (CHEBI:30294) |
| IUPAC Names |
|---|
| stiboric acid |
| trihydroxidooxidoantimony |
| Synonyms | Source |
|---|---|
| H3SbO4 | IUPAC |
| [SbO(OH)3] | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Gmelin:164200 | Gmelin |
| Gmelin:187051 | Gmelin |