EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H27N5O5 |
| Net Charge | 0 |
| Average Mass | 357.411 |
| Monoisotopic Mass | 357.20122 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H]1O[C@@H]1C(=O)O)C(=O)NCCCCNC(=N)N |
| InChI | InChI=1S/C15H27N5O5/c1-8(2)7-9(20-13(22)10-11(25-10)14(23)24)12(21)18-5-3-4-6-19-15(16)17/h8-11H,3-7H2,1-2H3,(H,18,21)(H,20,22)(H,23,24)(H4,16,17,19)/t9-,10-,11-/m0/s1 |
| InChIKey | LTLYEAJONXGNFG-DCAQKATOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| E64 (CHEBI:30270) has role antimalarial (CHEBI:38068) |
| E64 (CHEBI:30270) has role antiparasitic agent (CHEBI:35442) |
| E64 (CHEBI:30270) has role protease inhibitor (CHEBI:37670) |
| E64 (CHEBI:30270) is a L-leucine derivative (CHEBI:25018) |
| E64 (CHEBI:30270) is a dicarboxylic acid monoamide (CHEBI:35735) |
| E64 (CHEBI:30270) is a epoxy monocarboxylic acid (CHEBI:23931) |
| E64 (CHEBI:30270) is a guanidines (CHEBI:24436) |
| E64 (CHEBI:30270) is tautomer of E64 zwitterion (CHEBI:192370) |
| Incoming Relation(s) |
| E64 zwitterion (CHEBI:192370) is tautomer of E64 (CHEBI:30270) |
| Synonyms | Source |
|---|---|
| (2S,3S)-3-[((1S)-1-{[4-(carbamimidamido)butyl]carbamoyl}-3-methylbutyl)carbamoyl]oxirane-2-carboxylic acid | IUPAC |
| (2S,3S)-3-(N-{(S)-1-[N-(4-guanidinobutyl)carbamoyl]3-methylbutyl}carbamoyl)oxirane-2-carboxylic acid | IUBMB |
| E 64 | ChemIDplus |
| E-64 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6666631 | Beilstein |
| CAS:66701-25-5 | KEGG COMPOUND |
| CAS:66701-25-5 | ChemIDplus |