EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16ClN5 |
| Net Charge | 0 |
| Average Mass | 229.715 |
| Monoisotopic Mass | 229.10942 |
| SMILES | CCNc1nc(Cl)nc(NC(C)(C)C)n1 |
| InChI | InChI=1S/C9H16ClN5/c1-5-11-7-12-6(10)13-8(14-7)15-9(2,3)4/h5H2,1-4H3,(H2,11,12,13,14,15) |
| InChIKey | FZXISNSWEXTPMF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terbutylazine (CHEBI:30263) has functional parent 6-chloro-1,3,5-triazine-2,4-diamine (CHEBI:27726) |
| terbutylazine (CHEBI:30263) has role environmental contaminant (CHEBI:78298) |
| terbutylazine (CHEBI:30263) has role herbicide (CHEBI:24527) |
| terbutylazine (CHEBI:30263) has role xenobiotic (CHEBI:35703) |
| terbutylazine (CHEBI:30263) is a chloro-1,3,5-triazine (CHEBI:38168) |
| terbutylazine (CHEBI:30263) is a diamino-1,3,5-triazine (CHEBI:38170) |
| IUPAC Name |
|---|
| N-(tert-butyl)-6-chloro-N'-ethyl-1,3,5-triazine-2,4-diamine |
| Synonyms | Source |
|---|---|
| Terbuthylazine | NIST Chemistry WebBook |
| Terbutylazine | ChemIDplus |
| Terbutylethylazine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 623 | PPDB |
| C18810 | KEGG COMPOUND |
| terbuthylazine | Alan Wood's Pesticides |
| Terbuthylazine | Wikipedia |
| Citations |
|---|