EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12Br2O3 |
| Net Charge | 0 |
| Average Mass | 424.088 |
| Monoisotopic Mass | 421.91532 |
| SMILES | CCc1oc2ccccc2c1C(=O)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C17H12Br2O3/c1-2-13-15(10-5-3-4-6-14(10)22-13)16(20)9-7-11(18)17(21)12(19)8-9/h3-8,21H,2H2,1H3 |
| InChIKey | WHQCHUCQKNIQEC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | uricosuric drug A gout suppressant that acts directly on the renal tubule to increase the excretion of uric acid, thus reducing its concentrations in plasma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzbromarone (CHEBI:3023) has functional parent 2,6-dibromophenol (CHEBI:19391) |
| benzbromarone (CHEBI:3023) has role uricosuric drug (CHEBI:35841) |
| benzbromarone (CHEBI:3023) is a 1-benzofurans (CHEBI:38830) |
| benzbromarone (CHEBI:3023) is a aromatic ketone (CHEBI:76224) |
| IUPAC Name |
|---|
| (3,5-dibromo-4-hydroxyphenyl)(2-ethyl-1-benzofuran-3-yl)methanone |
| Synonyms | Source |
|---|---|
| 2-ethyl-3-(3,5-dibrom-4-hydroxybenzoyl)benzofuran | ChemIDplus |
| 3,5-dibromo-4-hydroxyphenyl-2-ethyl-3-benzofuranyl ketone | ChemIDplus |
| Benzbromarone | KEGG DRUG |
| Uroleap (TN) | KEGG DRUG |
| Citations |
|---|