EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3023 - benzbromarone
| Formula | C17H12Br2O3 |
| Net Charge | 0 |
| Average Mass | 424.088 |
| Monoisotopic Mass | 421.91532 |
| SMILES | CCc1oc2ccccc2c1C(=O)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C17H12Br2O3/c1-2-13-15(10-5-3-4-6-14(10)22-13)16(20)9-7-11(18)17(21)12(19)8-9/h3-8,21H,2H2,1H3 |
| InChIKey | WHQCHUCQKNIQEC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. uricosuric drug A gout suppressant that acts directly on the renal tubule to increase the excretion of uric acid, thus reducing its concentrations in plasma. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzbromarone (CHEBI:3023) has functional parent 2,6-dibromophenol (CHEBI:19391) |
| benzbromarone (CHEBI:3023) has role antihypertensive agent (CHEBI:35674) |
| benzbromarone (CHEBI:3023) has role gout suppressant (CHEBI:35845) |
| benzbromarone (CHEBI:3023) has role uricosuric drug (CHEBI:35841) |
| benzbromarone (CHEBI:3023) is a 1-benzofurans (CHEBI:38830) |
| benzbromarone (CHEBI:3023) is a aromatic ketone (CHEBI:76224) |
| benzbromarone (CHEBI:3023) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (3,5-dibromo-4-hydroxyphenyl)(2-ethyl-1-benzofuran-3-yl)methanone |
| INN | Source |
|---|---|
| benzbromarona | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-ethyl-3-(3,5-dibrom-4-hydroxybenzoyl)benzofuran | ChemIDplus |
| 3,5-dibromo-4-hydroxyphenyl-2-ethyl-3-benzofuranyl ketone | ChemIDplus |
| Benzbromarone | KEGG DRUG |
| Benzpromarone | ChEMBL |
| L-2214 | ChEMBL |
| MJ 10061 | ChEMBL |
| Brand Names | Source |
|---|---|
| Desuric | ChEMBL |
| Narcaricin mite | ChEMBL |
| Citations |
|---|