EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13ClNR |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 170.659 |
| Monoisotopic Mass (excl. R groups) | 170.07365 |
| SMILES | *[N+](C)(C)Cc1ccccc1.[Cl-] |
| Roles Classification |
|---|
| Chemical Roles: | detergent A surfactant (or a mixture containing one or more surfactants) having cleaning properties in dilute solutions. surfactant A substance which lowers the surface tension of the medium in which it is dissolved, and/or the interfacial tension with other phases, and, accordingly, is positively adsorbed at the liquid/vapour and/or at other interfaces. |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. disinfectant An antimicrobial agent that is applied to non-living objects to destroy harmful microorganisms or to inhibit their activity. |
| Applications: | detergent A surfactant (or a mixture containing one or more surfactants) having cleaning properties in dilute solutions. antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzalkonium chloride (CHEBI:3020) has role antibacterial agent (CHEBI:33282) |
| benzalkonium chloride (CHEBI:3020) has role antiseptic drug (CHEBI:48218) |
| benzalkonium chloride (CHEBI:3020) has role detergent (CHEBI:27780) |
| benzalkonium chloride (CHEBI:3020) has role disinfectant (CHEBI:48219) |
| benzalkonium chloride (CHEBI:3020) has role surfactant (CHEBI:35195) |
| benzalkonium chloride (CHEBI:3020) is a organic chloride salt (CHEBI:36094) |
| benzalkonium chloride (CHEBI:3020) is a quaternary ammonium salt (CHEBI:35273) |
| INNs | Source |
|---|---|
| benzalkonii chloridum | ChemIDplus |
| benzalkonium chloride | KEGG DRUG |
| chlorure de benzalkonium | ChemIDplus |
| cloruro de benzalconio | ChemIDplus |
| Synonyms | Source |
|---|---|
| ADBAC | ChEBI |
| Alkylbenzyldimethylammonium chloride | ChemIDplus |
| Alkyl dimethylbenzyl ammonium chloride | ChemIDplus |
| Alkyldimethylbenzylammonium chloride | ChemIDplus |
| Alkyldimethyl(phenylmethyl)quaternary ammonium chlorides | ChemIDplus |
| Benzalkonium chloride | KEGG COMPOUND |
| Citations |
|---|