EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:30183 - tetramethyllead
| Formula | C4H12Pb |
| Net Charge | 0 |
| Average Mass | 267.340 |
| Monoisotopic Mass | 268.07055 |
| SMILES | [CH3][Pb]([CH3])([CH3])[CH3] |
| InChI | InChI=1S/4CH3.Pb/h4*1H3; |
| InChIKey | XOOGZRUBTYCLHG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| Application: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetramethyllead (CHEBI:30183) has role NMR chemical shift reference compound (CHEBI:228364) |
| tetramethyllead (CHEBI:30183) is a organolead compound (CHEBI:33586) |
| IUPAC Names |
|---|
| tetramethyllead |
| tetramethylplumbane |
| Synonyms | Source |
|---|---|
| PbMe4 | IUPAC |
| tetramethyl lead | ChemIDplus |
| TML | NIST Chemistry WebBook |
| Bleitetramethyl | ChEBI |
| lead tetramethyl | ChemIDplus |