EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3018 - bentazone
| Formula | C10H12N2O3S |
| Net Charge | 0 |
| Average Mass | 240.284 |
| Monoisotopic Mass | 240.05686 |
| SMILES | CC(C)N1C(=O)c2ccccc2NS1(=O)=O |
| InChI | InChI=1S/C10H12N2O3S/c1-7(2)12-10(13)8-5-3-4-6-9(8)11-16(12,14)15/h3-7,11H,1-2H3 |
| InChIKey | ZOMSMJKLGFBRBS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bentazone (CHEBI:3018) has role environmental contaminant (CHEBI:78298) |
| bentazone (CHEBI:3018) has role herbicide (CHEBI:24527) |
| bentazone (CHEBI:3018) has role xenobiotic (CHEBI:35703) |
| bentazone (CHEBI:3018) is a benzothiadiazine (CHEBI:50265) |
| IUPAC Name |
|---|
| 3-(propan-2-yl)-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-dioxide |
| Citations |
|---|