EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:30178 - sodium perborate
| Formula | H4B2O8.2Na |
| Net Charge | 0 |
| Average Mass | 199.628 |
| Monoisotopic Mass | 199.98877 |
| SMILES | O[B-]1(O)OO[B-](O)(O)OO1.[Na+].[Na+] |
| InChI | InChI=1S/B2H4O8.2Na/c3-1(4)7-9-2(5,6)10-8-1;;/h3-6H;;/q-2;2*+1 |
| InChIKey | JBUKJLNBQDQXLI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | bleaching agent A reagent that lightens or whitens a substrate through chemical reaction. Bleaching reactions usually involve oxidative or reductive processes that degrade colour systems. Bleaching can occur by destroying one or more of the double bonds in the conjugated chain, by cleaving the conjugated chain, or by oxidation of one of the other moieties in the conjugated chain. Their reactivity results in many bleaches having strong bactericidal, disinfecting, and sterilising properties. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium perborate (CHEBI:30178) has part perborate(2−) (CHEBI:30175) |
| sodium perborate (CHEBI:30178) has role antiinfective agent (CHEBI:35441) |
| sodium perborate (CHEBI:30178) has role bleaching agent (CHEBI:132717) |
| sodium perborate (CHEBI:30178) is a inorganic sodium salt (CHEBI:38702) |
| sodium perborate (CHEBI:30178) is a organic molecular entity (CHEBI:50860) |
| sodium perborate (CHEBI:30178) is a oxoanion (CHEBI:35406) |
| IUPAC Name |
|---|
| disodium tetrahydroxidodi-μ-peroxido-diborate |
| Synonyms | Source |
|---|---|
| Dexol | ChEMBL |
| Na2[B2(O2)2(OH)4] | ChEBI |
| Sodium perborate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Bocasan | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Gmelin:121732 | Gmelin |
| CAS:15120-21-5 | ChemIDplus |