EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H4B2O8.2Na |
| Net Charge | 0 |
| Average Mass | 199.628 |
| Monoisotopic Mass | 199.98877 |
| SMILES | O[B-]1(O)OO[B-](O)(O)OO1.[Na+].[Na+] |
| InChI | InChI=1S/B2H4O8.2Na/c3-1(4)7-9-2(5,6)10-8-1;;/h3-6H;;/q-2;2*+1 |
| InChIKey | JBUKJLNBQDQXLI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. bleaching agent A reagent that lightens or whitens a substrate through chemical reaction. Bleaching reactions usually involve oxidative or reductive processes that degrade colour systems. Bleaching can occur by destroying one or more of the double bonds in the conjugated chain, by cleaving the conjugated chain, or by oxidation of one of the other moieties in the conjugated chain. Their reactivity results in many bleaches having strong bactericidal, disinfecting, and sterilising properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium perborate (CHEBI:30178) has part perborate(2−) (CHEBI:30175) |
| sodium perborate (CHEBI:30178) has role antiinfective agent (CHEBI:35441) |
| sodium perborate (CHEBI:30178) has role bleaching agent (CHEBI:132717) |
| sodium perborate (CHEBI:30178) is a inorganic sodium salt (CHEBI:38702) |
| IUPAC Name |
|---|
| disodium tetrahydroxidodi-μ-peroxido-diborate |
| Synonyms | Source |
|---|---|
| Dexol | ChEMBL |
| Na2[B2(O2)2(OH)4] | ChEBI |
| Sodium perborate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Bocasan | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Gmelin:121732 | Gmelin |
| CAS:15120-21-5 | ChemIDplus |