EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2H.H4B2O8 |
| Net Charge | 0 |
| Average Mass | 155.664 |
| Monoisotopic Mass | 156.02488 |
| SMILES | O[B-]1(O)OO[B-](O)(O)OO1.[H+].[H+] |
| InChI | InChI=1S/B2H4O8/c3-1(4)7-9-2(5,6)10-8-1/h3-6H/q-2/p+2 |
| InChIKey | PNIJRIIGBGFYHF-UHFFFAOYSA-P |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perboric acid (CHEBI:30174) is a boric acids (CHEBI:59765) |
| IUPAC Names |
|---|
| dihydrogen(tetrahydroxidodi-μ-peroxido-diborate) |
| tetrahydroxo-di-(μ-peroxo)diboric(2−) acid |
| dihydrogen tetrahydroxo-di-μ-peroxo-diborate(2−) |
| Synonyms | Source |
|---|---|
| perboric acid | IUPAC |
| H2[(OH)2B(μ-OO)2B(OH)2] | ChEBI |
| H2B2(O2)2(OH)4 | IUPAC |