EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:30172 - metaboric acid
| Formula | (HBO2)n.H4B2O5 |
| Net Charge | 0 |
| Average Mass | 149.469 |
| Monoisotopic Mass | 150.03144 |
| SMILES | OB(O)OB(O)OB(O)O |
| InChI | InChI=1S/B3H5O7/c4-1(5)9-3(8)10-2(6)7/h4-8H |
| InChIKey | PJVLTQOLISOGIB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metaboric acid (CHEBI:30172) is a boric acids (CHEBI:59765) |
| IUPAC Names |
|---|
| catena-poly[hydroxidoboron-μ-oxido] |
| metaboric acid |
| Synonyms | Source |
|---|---|
| (HBO2)n | IUPAC |
| ((̶B(OH)O))̶n | IUPAC |
| boron oxide hydroxide | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Gmelin:121829 | Gmelin |
| CAS:13460-50-9 | NIST Chemistry WebBook |