EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N4O3 |
| Net Charge | 0 |
| Average Mass | 290.323 |
| Monoisotopic Mass | 290.13789 |
| SMILES | CCCCNC(=O)n1c(NC(=O)OC)nc2ccccc21 |
| InChI | InChI=1S/C14H18N4O3/c1-3-4-9-15-13(19)18-11-8-6-5-7-10(11)16-12(18)17-14(20)21-2/h5-8H,3-4,9H2,1-2H3,(H,15,19)(H,16,17,20) |
| InChIKey | RIOXQFHNBCKOKP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | tubulin modulator Any substance that interacts with tubulin to inhibit or promote polymerisation of microtubules. microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| Applications: | anthelminthic drug Substance intended to kill parasitic worms (helminths). acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benomyl (CHEBI:3015) has role acaricide (CHEBI:22153) |
| benomyl (CHEBI:3015) has role anthelminthic drug (CHEBI:35443) |
| benomyl (CHEBI:3015) has role antifungal agrochemical (CHEBI:86328) |
| benomyl (CHEBI:3015) has role microtubule-destabilising agent (CHEBI:61951) |
| benomyl (CHEBI:3015) has role tubulin modulator (CHEBI:60832) |
| benomyl (CHEBI:3015) is a aromatic amide (CHEBI:62733) |
| benomyl (CHEBI:3015) is a benzimidazole fungicide (CHEBI:87036) |
| benomyl (CHEBI:3015) is a benzimidazoles (CHEBI:22715) |
| benomyl (CHEBI:3015) is a benzimidazolylcarbamate fungicide (CHEBI:87064) |
| benomyl (CHEBI:3015) is a carbamate ester (CHEBI:23003) |
| IUPAC Name |
|---|
| methyl [1-(butylcarbamoyl)-1H-benzimidazol-2-yl]carbamate |
| Synonyms | Source |
|---|---|
| 1-(Butylcarbamoyl)-2-benzimidazolecarbamic acid, methyl ester | ChemIDplus |
| 1-(Butylcarbamoyl)-2-benzimidazol-methylcarbamat | ChemIDplus |
| 1-(N-Butylcarbamoyl)-2-(methoxy-carboxamido)-benzimidazol | ChemIDplus |
| Benlate | KEGG COMPOUND |
| Benlate | KEGG COMPOUND |
| Benomyl | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 66 | PPDB |
| benomyl | Alan Wood's Pesticides |
| Benomyl | Wikipedia |
| C10896 | KEGG COMPOUND |
| HMDB0031767 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:825455 | Reaxys |
| CAS:17804-35-2 | NIST Chemistry WebBook |
| CAS:17804-35-2 | KEGG COMPOUND |
| CAS:17804-35-2 | ChemIDplus |
| Citations |
|---|