EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | [H][C@]12C[C@H](O)C(C)=C(CC[C@]3(C)CC[C@H](O)C(=C)[C@@]3([H])C1)C2(C)C |
| InChI | InChI=1S/C20H32O2/c1-12-15-6-8-20(5)9-7-17(21)13(2)16(20)10-14(11-18(12)22)19(15,3)4/h14,16-18,21-22H,2,6-11H2,1,3-5H3/t14-,16-,17+,18+,20-/m1/s1 |
| InChIKey | VTDWDDILICLAEK-RDGCENLJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taxa-4(20),11-dien-5α,13α-diol (CHEBI:30041) has role metabolite (CHEBI:25212) |
| taxa-4(20),11-dien-5α,13α-diol (CHEBI:30041) is a diol (CHEBI:23824) |
| taxa-4(20),11-dien-5α,13α-diol (CHEBI:30041) is a secondary alcohol (CHEBI:35681) |
| taxa-4(20),11-dien-5α,13α-diol (CHEBI:30041) is a taxane diterpenoid (CHEBI:50367) |
| IUPAC Name |
|---|
| (5α,13α)-taxa-4(20),11-diene-5,13-diol |
| Synonyms | Source |
|---|---|
| Taxa-4(20),11(12)-dien-5alpha,13alpha-diol | KEGG COMPOUND |
| taxa-4(20),11(12)-dien-5α,13α-diol | LIPID MAPS |
| UniProt Name | Source |
|---|---|
| taxa-4(20),11-dien-5α,13α-diol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C11897 | KEGG COMPOUND |
| LMPR0104390005 | LIPID MAPS |
| TAXA-42011-DIEN-5A13A-DIOL | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:357436-25-0 | KEGG COMPOUND |