EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11O5 |
| Net Charge | -1 |
| Average Mass | 223.204 |
| Monoisotopic Mass | 223.06120 |
| SMILES | COc1cc(/C=C/C(=O)[O-])cc(OC)c1O |
| InChI | InChI=1S/C11H12O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h3-6,14H,1-2H3,(H,12,13)/p-1/b4-3+ |
| InChIKey | PCMORTLOPMLEFB-ONEGZZNKSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-sinapate (CHEBI:30023) has role plant metabolite (CHEBI:76924) |
| trans-sinapate (CHEBI:30023) is a cinnamates (CHEBI:36091) |
| trans-sinapate (CHEBI:30023) is conjugate base of trans-sinapic acid (CHEBI:15714) |
| Incoming Relation(s) |
| trans-sinapoyl-AMP(1−) (CHEBI:192469) has functional parent trans-sinapate (CHEBI:30023) |
| trans-sinapic acid (CHEBI:15714) is conjugate acid of trans-sinapate (CHEBI:30023) |
| IUPAC Name |
|---|
| (2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
| Synonyms | Source |
|---|---|
| 3,5-dimethoxy-4-hydroxycinnamate | ChEBI |
| Sinapate | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (E)-sinapate | UniProt |