EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H37ClO7 |
| Net Charge | 0 |
| Average Mass | 521.050 |
| Monoisotopic Mass | 520.22278 |
| SMILES | [H][C@@]12C[C@H](C)[C@](OC(=O)CC)(C(=O)COC(=O)CC)[C@@]1(C)C[C@H](O)[C@@]1(Cl)[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C28H37ClO7/c1-6-23(33)35-15-22(32)28(36-24(34)7-2)16(3)12-20-19-9-8-17-13-18(30)10-11-25(17,4)27(19,29)21(31)14-26(20,28)5/h10-11,13,16,19-21,31H,6-9,12,14-15H2,1-5H3/t16-,19-,20-,21-,25-,26-,27-,28-/m0/s1 |
| InChIKey | KUVIULQEHSCUHY-XYWKZLDCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. anti-asthmatic drug A drug used to treat asthma. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| beclomethasone dipropionate (CHEBI:3002) has functional parent beclomethasone (CHEBI:3001) |
| beclomethasone dipropionate (CHEBI:3002) has role anti-arrhythmia drug (CHEBI:38070) |
| beclomethasone dipropionate (CHEBI:3002) has role anti-asthmatic drug (CHEBI:49167) |
| beclomethasone dipropionate (CHEBI:3002) has role anti-inflammatory drug (CHEBI:35472) |
| beclomethasone dipropionate (CHEBI:3002) has role prodrug (CHEBI:50266) |
| beclomethasone dipropionate (CHEBI:3002) is a 11β-hydroxy steroid (CHEBI:35346) |
| beclomethasone dipropionate (CHEBI:3002) is a 20-oxo steroid (CHEBI:36885) |
| beclomethasone dipropionate (CHEBI:3002) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| beclomethasone dipropionate (CHEBI:3002) is a chlorinated steroid (CHEBI:77175) |
| beclomethasone dipropionate (CHEBI:3002) is a corticosteroid (CHEBI:50858) |
| beclomethasone dipropionate (CHEBI:3002) is a enone (CHEBI:51689) |
| beclomethasone dipropionate (CHEBI:3002) is a glucocorticoid (CHEBI:24261) |
| beclomethasone dipropionate (CHEBI:3002) is a propanoate ester (CHEBI:36243) |
| beclomethasone dipropionate (CHEBI:3002) is a steroid ester (CHEBI:47880) |
| IUPAC Name |
|---|
| (11β,16β)-9-chloro-11-hydroxy-16-methyl-3,20-dioxopregna-1,4-diene-17,21-diyl dipropanoate |
| Synonyms | Source |
|---|---|
| Beclomethasone dipropionate | KEGG COMPOUND |
| Beclometasone dipropionate | KEGG COMPOUND |
| 9-chloro-11β-hydroxy-16β-methylpregna-1,4-diene-3,20-dione 17,21-dipropionate | ChemIDplus |
| (11β,16β)-9-chloro-11-hydroxy-16-methyl-17,21-bis(1-oxopropoxy)pregna-1,4-diene-3,20-dione | ChemIDplus |
| beclometasone 17,21-dipropionate | ChemIDplus |
| 9-chloro-16β-methyl-11β,17,21-trihydroxypregna-1,4-diene-3,20-dione 17,21-dipropionate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Viarox | DrugBank |
| Rino-Clenil | DrugBank |
| Vancenase | DrugBank |
| Anceron | DrugBank |
| Beclacin | DrugBank |
| Beclovent | DrugBank |
| Citations |
|---|