EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H57N3O9 |
| Net Charge | 0 |
| Average Mass | 783.963 |
| Monoisotopic Mass | 783.40948 |
| SMILES | CC(C)[C@H]1OC(=O)[C@H](Cc2ccccc2)N(C)C(=O)[C@@H](C(C)C)OC(=O)[C@H](Cc2ccccc2)N(C)C(=O)[C@@H](C(C)C)OC(=O)[C@H](Cc2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C45H57N3O9/c1-28(2)37-40(49)46(7)35(26-32-21-15-11-16-22-32)44(53)56-39(30(5)6)42(51)48(9)36(27-33-23-17-12-18-24-33)45(54)57-38(29(3)4)41(50)47(8)34(43(52)55-37)25-31-19-13-10-14-20-31/h10-24,28-30,34-39H,25-27H2,1-9H3/t34-,35-,36-,37+,38+,39+/m0/s1 |
| InChIKey | GYSCAQFHASJXRS-FFCOJMSVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beauveria bassiana (ncbitaxon:176275) | - | PubMed (18804027) | |
| Fusarium avenaceum (ncbitaxon:40199) | - | PubMed (25475336) | |
| Fusarium equiseti (ncbitaxon:61235) | - | PubMed (25475336) | |
| Fusarium poae (ncbitaxon:36050) | - | PubMed (25475336) | |
| Fusarium proliferatum (ncbitaxon:948311) | - | PubMed (23832252) | |
| Fusarium sporotrichioides (ncbitaxon:5514) | - | PubMed (25475336) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | ionophore A compound which can carry specific ions through membranes of cells or organelles. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. mycotoxin Poisonous substance produced by fungi. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| beauvericin (CHEBI:3000) has role antibiotic insecticide (CHEBI:39208) |
| beauvericin (CHEBI:3000) has role antifungal agent (CHEBI:35718) |
| beauvericin (CHEBI:3000) has role antineoplastic agent (CHEBI:35610) |
| beauvericin (CHEBI:3000) has role apoptosis inhibitor (CHEBI:68494) |
| beauvericin (CHEBI:3000) has role fungal metabolite (CHEBI:76946) |
| beauvericin (CHEBI:3000) has role ionophore (CHEBI:24869) |
| beauvericin (CHEBI:3000) has role mycotoxin (CHEBI:25442) |
| beauvericin (CHEBI:3000) has role P450 inhibitor (CHEBI:50183) |
| beauvericin (CHEBI:3000) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3S,6R,9S,12R,15S,18R)-3,9,15-tribenzyl-4,10,16-trimethyl-6,12,18-tri(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
| Synonyms | Source |
|---|---|
| (3S,6R,9S,12R,15S,18R)-3,9,15-tribenzyl-6,12,18-triisopropyl-4,10,16-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone | IUPAC |
| Beauvericin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| beauvericin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Beauvericin | Wikipedia |
| C00027924 | KNApSAcK |
| C11590 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24193536 | Reaxys |
| Reaxys:5223711 | Reaxys |
| CAS:26048-05-5 | KEGG COMPOUND |
| CAS:26048-05-5 | ChemIDplus |
| Citations |
|---|