EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H57N3O9 |
| Net Charge | 0 |
| Average Mass | 783.963 |
| Monoisotopic Mass | 783.40948 |
| SMILES | CC(C)[C@H]1OC(=O)[C@H](Cc2ccccc2)N(C)C(=O)[C@@H](C(C)C)OC(=O)[C@H](Cc2ccccc2)N(C)C(=O)[C@@H](C(C)C)OC(=O)[C@H](Cc2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C45H57N3O9/c1-28(2)37-40(49)46(7)35(26-32-21-15-11-16-22-32)44(53)56-39(30(5)6)42(51)48(9)36(27-33-23-17-12-18-24-33)45(54)57-38(29(3)4)41(50)47(8)34(43(52)55-37)25-31-19-13-10-14-20-31/h10-24,28-30,34-39H,25-27H2,1-9H3/t34-,35-,36-,37+,38+,39+/m0/s1 |
| InChIKey | GYSCAQFHASJXRS-FFCOJMSVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beauveria bassiana (ncbitaxon:176275) | - | PubMed (18804027) | |
| Fusarium avenaceum (ncbitaxon:40199) | - | PubMed (25475336) | |
| Fusarium equiseti (ncbitaxon:61235) | - | PubMed (25475336) | |
| Fusarium poae (ncbitaxon:36050) | - | PubMed (25475336) | |
| Fusarium proliferatum (ncbitaxon:948311) | - | PubMed (23832252) | |
| Fusarium sporotrichioides (ncbitaxon:5514) | - | PubMed (25475336) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ionophore A compound which can carry specific ions through membranes of cells or organelles. mycotoxin Poisonous substance produced by fungi. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| beauvericin (CHEBI:3000) has role antibiotic insecticide (CHEBI:39208) |
| beauvericin (CHEBI:3000) has role antifungal agent (CHEBI:35718) |
| beauvericin (CHEBI:3000) has role antineoplastic agent (CHEBI:35610) |
| beauvericin (CHEBI:3000) has role apoptosis inhibitor (CHEBI:68494) |
| beauvericin (CHEBI:3000) has role fungal metabolite (CHEBI:76946) |
| beauvericin (CHEBI:3000) has role ionophore (CHEBI:24869) |
| beauvericin (CHEBI:3000) has role mycotoxin (CHEBI:25442) |
| beauvericin (CHEBI:3000) has role P450 inhibitor (CHEBI:50183) |
| beauvericin (CHEBI:3000) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3S,6R,9S,12R,15S,18R)-3,9,15-tribenzyl-4,10,16-trimethyl-6,12,18-tri(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
| Synonyms | Source |
|---|---|
| (3S,6R,9S,12R,15S,18R)-3,9,15-tribenzyl-6,12,18-triisopropyl-4,10,16-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone | IUPAC |
| Beauvericin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| beauvericin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Beauvericin | Wikipedia |
| C00027924 | KNApSAcK |
| C11590 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24193536 | Reaxys |
| Reaxys:5223711 | Reaxys |
| CAS:26048-05-5 | KEGG COMPOUND |
| CAS:26048-05-5 | ChemIDplus |
| Citations |
|---|