EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6NO4 |
| Net Charge | -1 |
| Average Mass | 132.095 |
| Monoisotopic Mass | 132.03023 |
| SMILES | [NH3+]C(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/p-1 |
| InChIKey | CKLJMWTZIZZHCS-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspartate(1−) (CHEBI:35391) has role fundamental metabolite (CHEBI:78675) |
| aspartate(1−) (CHEBI:35391) is a aspartate (CHEBI:132943) |
| aspartate(1−) (CHEBI:35391) is conjugate acid of aspartate(2−) (CHEBI:29995) |
| aspartate(1−) (CHEBI:35391) is conjugate base of aspartic acid (CHEBI:22660) |
| Incoming Relation(s) |
| D-aspartate(1−) (CHEBI:29990) is a aspartate(1−) (CHEBI:35391) |
| L-aspartate(1−) (CHEBI:29991) is a aspartate(1−) (CHEBI:35391) |
| aspartic acid (CHEBI:22660) is conjugate acid of aspartate(1−) (CHEBI:35391) |
| aspartate(2−) (CHEBI:29995) is conjugate base of aspartate(1−) (CHEBI:35391) |
| aspartate residue (CHEBI:32471) is substituent group from aspartate(1−) (CHEBI:35391) |
| IUPAC Name |
|---|
| hydrogen aspartate |
| Synonyms | Source |
|---|---|
| 2-ammoniobutanedioate | IUPAC |
| 2-ammoniosuccinate | ChEBI |
| aspartate(1−) | JCBN |
| aspartic acid monoanion | JCBN |