EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H68O15 |
| Net Charge | 0 |
| Average Mass | 812.991 |
| Monoisotopic Mass | 812.45582 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)C[C@H](O)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@@]1(C)CO |
| InChI | InChI=1S/C42H68O15/c1-37(2)11-13-42(36(52)53)14-12-40(5)20(21(42)15-37)7-8-26-38(3)16-22(46)33(39(4,19-45)25(38)9-10-41(26,40)6)57-35-31(51)29(49)32(24(18-44)55-35)56-34-30(50)28(48)27(47)23(17-43)54-34/h7,21-35,43-51H,8-19H2,1-6H3,(H,52,53)/t21-,22-,23+,24+,25+,26+,27+,28-,29+,30+,31+,32+,33-,34-,35-,38-,39-,40+,41+,42-/m0/s1 |
| InChIKey | GQPGGSOQFNPVJI-XXRVHFCASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phytolacca dodecandra (ncbitaxon:29724) | - | Article (Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter53) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bayogenin 3-O-cellobioside (CHEBI:2999) has functional parent bayogenin (CHEBI:50481) |
| bayogenin 3-O-cellobioside (CHEBI:2999) has role plant metabolite (CHEBI:76924) |
| bayogenin 3-O-cellobioside (CHEBI:2999) is a cellobioside (CHEBI:50485) |
| bayogenin 3-O-cellobioside (CHEBI:2999) is a disaccharide derivative (CHEBI:63353) |
| bayogenin 3-O-cellobioside (CHEBI:2999) is a monocarboxylic acid (CHEBI:25384) |
| bayogenin 3-O-cellobioside (CHEBI:2999) is a pentacyclic triterpenoid (CHEBI:25872) |
| bayogenin 3-O-cellobioside (CHEBI:2999) is a triterpenoid saponin (CHEBI:61778) |
| IUPAC Name |
|---|
| 3β-[O-β-D-glucopyranosyl-(1→4)-β-D-glucopyranosyloxy]-2β,23-dihydroxyolean-12-en-28-oic acid |
| Synonym | Source |
|---|---|
| Bayogenin 3-O-cellobioside | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C08932 | KEGG COMPOUND |
| C00003506 | KNApSAcK |
| LMPR0106150009 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6467731 | Reaxys |
| CAS:92622-05-4 | KEGG COMPOUND |