EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:29989 - D-glutamate(2−)
| Formula | C5H7NO4 |
| Net Charge | -2 |
| Average Mass | 145.114 |
| Monoisotopic Mass | 145.03860 |
| SMILES | N[C@H](CCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/p-2/t3-/m1/s1 |
| InChIKey | WHUUTDBJXJRKMK-GSVOUGTGSA-L |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glutamate(2−) (CHEBI:29989) is a glutamate(2−) (CHEBI:29987) |
| D-glutamate(2−) (CHEBI:29989) is conjugate base of D-glutamate(1−) (CHEBI:29986) |
| D-glutamate(2−) (CHEBI:29989) is enantiomer of L-glutamate(2−) (CHEBI:29988) |
| Incoming Relation(s) |
| N-acyl-D-glutamates(2−) (CHEBI:17503) has functional parent D-glutamate(2−) (CHEBI:29989) |
| D-glutamate(1−) (CHEBI:29986) is conjugate acid of D-glutamate(2−) (CHEBI:29989) |
| L-glutamate(2−) (CHEBI:29988) is enantiomer of D-glutamate(2−) (CHEBI:29989) |
| IUPAC Names |
|---|
| (2R)-2-aminopentanedioate |
| D-glutamate |
| Synonyms | Source |
|---|---|
| D-glutamate(2−) | JCBN |
| D-glutamic acid dianion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:327904 | Gmelin |
| Beilstein:8143000 | Beilstein |