EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O4 |
| Net Charge | 0 |
| Average Mass | 284.311 |
| Monoisotopic Mass | 284.10486 |
| SMILES | COc1cc(OC)c2c(ccc3cc(OC)c(O)cc32)c1 |
| InChI | InChI=1S/C17H16O4/c1-19-12-6-11-5-4-10-7-15(20-2)14(18)9-13(10)17(11)16(8-12)21-3/h4-9,18H,1-3H3 |
| InChIKey | KGYHMWVRKYFQQR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Batatasin I (CHEBI:2996) is a phenanthrol (CHEBI:25962) |
| Synonyms | Source |
|---|---|
| 2,5,7-Trimethoxyphenanthren-3-ol | KEGG COMPOUND |
| Batatasin I | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000325 | KNApSAcK |
| C10246 | KEGG COMPOUND |
| HMDB0038778 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:51415-00-0 | KEGG COMPOUND |