EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O5 |
| Net Charge | 0 |
| Average Mass | 490.725 |
| Monoisotopic Mass | 490.36582 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)[C@@H](O)[C@H](O)[C@]4(CO)[C@H](O)C[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H50O5/c1-25(2)14-18-17-8-9-20-27(5)12-11-21(32)26(3,4)19(27)10-13-28(20,6)29(17,7)15-22(33)30(18,16-31)24(35)23(25)34/h8,18-24,31-35H,9-16H2,1-7H3/t18-,19-,20+,21-,22+,23-,24-,27-,28+,29+,30-/m0/s1 |
| InChIKey | AYDKOFQQBHRXEW-AAUPIIFFSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| barringtogenol C (CHEBI:2994) has parent hydride oleanane (CHEBI:36481) |
| barringtogenol C (CHEBI:2994) has role plant metabolite (CHEBI:76924) |
| barringtogenol C (CHEBI:2994) is a pentacyclic triterpenoid (CHEBI:25872) |
| barringtogenol C (CHEBI:2994) is a pentol (CHEBI:37205) |
| barringtogenol C (CHEBI:2994) is a sapogenin (CHEBI:26606) |
| Incoming Relation(s) |
| clethroidoside B (CHEBI:69602) has functional parent barringtogenol C (CHEBI:2994) |
| IUPAC Name |
|---|
| (3β,16α,21β,22α)-olean-12-ene-3,16,21,22,28-pentol |
| Synonyms | Source |
|---|---|
| Careyagenol A | HMDB |
| Giganteumgenin M | HMDB |
| Acutangenol B | HMDB |
| Saniculagenin D | HMDB |
| Theasapogenol B | HMDB |
| Aescinidin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C08931 | KEGG COMPOUND |
| HMDB0034525 | HMDB |
| C00003505 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2229015 | Reaxys |
| CAS:13844-01-4 | ChemIDplus |
| Citations |
|---|