EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H46N2O10 |
| Net Charge | 0 |
| Average Mass | 666.768 |
| Monoisotopic Mass | 666.31525 |
| SMILES | [H][C@@]12C[C@@]3([H])C(=O)[C@]1([H])[C@](O)(C[C@@H]3OC)[C@]1(O)C3N(CC)C[C@]4(COC(=O)c5ccccc5N5C(=O)C[C@H](C)C5=O)CC[C@H](OC)[C@@]32[C@]4([H])[C@@H]1OC |
| InChI | InChI=1S/C36H46N2O10/c1-6-37-16-33(17-48-31(42)19-9-7-8-10-22(19)38-25(39)13-18(2)30(38)41)12-11-24(46-4)35-21-14-20-23(45-3)15-34(43,26(21)27(20)40)36(44,32(35)37)29(47-5)28(33)35/h7-10,18,20-21,23-24,26,28-29,32,43-44H,6,11-17H2,1-5H3/t18-,20+,21+,23-,24-,26+,28+,29-,32?,33-,34+,35-,36+/m0/s1 |
| InChIKey | VBFGMIUWGBSAGV-UCFHPTPSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Delphinium nuttallianum (ncbitaxon:136334) | - | PubMed (19012276) | |
| Delphinium andersonii (ncbitaxon:136314) | - | PubMed (19012276) | |
| Delphinium glaucescens (ncbitaxon:136323) | - | DOI (10.1021/jf00025a020) | |
| Delphinium barbeyi (ncbitaxon:136316) | - | DOI (10.1021/jf00025a020) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | phytotoxin Any toxin produced by a plant. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| barbinine (CHEBI:2992) has parent hydride aconitane (CHEBI:35911) |
| barbinine (CHEBI:2992) has role phytotoxin (CHEBI:38231) |
| barbinine (CHEBI:2992) is a benzoate ester (CHEBI:36054) |
| barbinine (CHEBI:2992) is a dicarboximide (CHEBI:35356) |
| barbinine (CHEBI:2992) is a diterpene alkaloid (CHEBI:23847) |
| barbinine (CHEBI:2992) is a ether (CHEBI:25698) |
| barbinine (CHEBI:2992) is a organic heteropolycyclic compound (CHEBI:38166) |
| barbinine (CHEBI:2992) is a pyrrolidinone (CHEBI:38275) |
| barbinine (CHEBI:2992) is a tertiary alcohol (CHEBI:26878) |
| barbinine (CHEBI:2992) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (20-ethyl-7,8-dihydroxy-1α,6β,16β-trimethoxy-14-oxoaconitan-4-yl)methyl 2-[(3S)-3-methyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| Synonyms | Source |
|---|---|
| Barbinine | KEGG COMPOUND |
| Aconitan-14-one, 7,8-dihydroxy-20-ethyl-4-(((2-(3-methyl-2,5-dioxo-1-pyrrolidinyl)benzoyl)oxy)methyl)-1,6,16-trimethoxy-, (1-alpha,4(S),6-beta,16-beta)- | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8181881 | Reaxys |
| Reaxys:10753152 | Reaxys |
| CAS:123497-99-4 | KEGG COMPOUND |
| CAS:123497-99-4 | ChemIDplus |
| Citations |
|---|