EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2O4 |
| Net Charge | 0 |
| Average Mass | 368.433 |
| Monoisotopic Mass | 368.17361 |
| SMILES | [H][C@@]12N3CC[C@]14C(=C(C(=O)OC)C[C@]2([C@H](C)O)CC(=O)C3)Nc1ccccc14 |
| InChI | InChI=1S/C21H24N2O4/c1-12(24)20-9-13(25)11-23-8-7-21(19(20)23)15-5-3-4-6-16(15)22-17(21)14(10-20)18(26)27-2/h3-6,12,19,22,24H,7-11H2,1-2H3/t12-,19-,20-,21-/m0/s1 |
| InChIKey | CQSFDKICYDHRGT-XSGSXHBCSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Baloxine (CHEBI:2988) is a alkaloid (CHEBI:22315) |
| Baloxine (CHEBI:2988) is a methyl ester (CHEBI:25248) |
| Synonym | Source |
|---|---|
| Baloxine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C09045 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:38225-09-1 | KEGG COMPOUND |