EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H12 |
| Net Charge | 0 |
| Average Mass | 300.360 |
| Monoisotopic Mass | 300.09390 |
| SMILES | c1cc2ccc3ccc4ccc5ccc6ccc1c1c2c3c4c5c61 |
| InChI | InChI=1S/C24H12/c1-2-14-5-6-16-9-11-18-12-10-17-8-7-15-4-3-13(1)19-20(14)22(16)24(18)23(17)21(15)19/h1-12H |
| InChIKey | VPUGDVKSAQVFFS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coronene (CHEBI:29863) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| IUPAC Name |
|---|
| coronene |
| Synonyms | Source |
|---|---|
| hexabenzobenzene | NIST Chemistry WebBook |
| superbenzene | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C19375 | KEGG COMPOUND |
| Coronene | Wikipedia |
| US2009044863 | Patent |
| Citations |
|---|