EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H12 |
| Net Charge | 0 |
| Average Mass | 252.316 |
| Monoisotopic Mass | 252.09390 |
| SMILES | c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17/h1-12H |
| InChIKey | CSHWQDPOILHKBI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perylene (CHEBI:29861) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| perylene (CHEBI:29861) is a perylenes (CHEBI:60201) |
| IUPAC Name |
|---|
| perylene |
| Synonyms | Source |
|---|---|
| dibenz[de,kl]anthracene | NIST Chemistry WebBook |
| peri-dinaphthalene | NIST Chemistry WebBook |
| Perylen | ChEBI |
| perilene | NIST Chemistry WebBook |
| α-perylene | ChemIDplus |
| Citations |
|---|