EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:29717 - dTDP 1-ester with 2,6-dideoxy-L-erythro-hexopyranos-3-ulose
| Formula | C16H24N2O14P2 |
| Net Charge | 0 |
| Average Mass | 530.316 |
| Monoisotopic Mass | 530.07028 |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O[C@@H]3CC(=O)[C@@H](O)[C@H](C)O3)O2)c(=O)nc1=O |
| InChI | InChI=1S/C16H24N2O14P2/c1-7-5-18(16(23)17-15(7)22)12-3-9(19)11(30-12)6-28-33(24,25)32-34(26,27)31-13-4-10(20)14(21)8(2)29-13/h5,8-9,11-14,19,21H,3-4,6H2,1-2H3,(H,24,25)(H,26,27)(H,17,22,23)/t8-,9-,11+,12+,13+,14-/m0/s1 |
| InChIKey | CZNNQWMLAHSKRA-NVAFIHLTSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dTDP 1-ester with 2,6-dideoxy-L-erythro-hexopyranos-3-ulose (CHEBI:29717) is a pyrimidine nucleotide-sugar (CHEBI:61109) |
| Synonyms | Source |
|---|---|
| dTDP 1-ester with 2,6-dideoxy-L-erythro-hexopyranos-3-ulose | KEGG COMPOUND |
| dTDP 1-ester with 2,6-dideoxy-L-erythro-hexopyranos-3-ulose | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11932 | KEGG COMPOUND |