EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N3O4S3 |
| Net Charge | 0 |
| Average Mass | 481.665 |
| Monoisotopic Mass | 481.11637 |
| SMILES | [H][C@]1(C2N[C@]([H])([C@@H](O)C(C)(C)C3=N[C@@](C)(C(=O)O)CS3)CS2)CSC(c2ccccc2O)=N1 |
| InChI | InChI=1S/C21H27N3O4S3/c1-20(2,18-24-21(3,10-31-18)19(27)28)15(26)12-8-30-17(22-12)13-9-29-16(23-13)11-6-4-5-7-14(11)25/h4-7,12-13,15,17,22,25-26H,8-10H2,1-3H3,(H,27,28)/t12-,13+,15+,17?,21+/m0/s1 |
| InChIKey | JHYVWAMMAMCUIR-VQNLDRKJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Yersinia enterocolitica (ncbitaxon:630) | - | DOI (/10.1016/S0040-4020(01)00012-6) | |
| Yersinia pestis (ncbitaxon:632) | - | PubMed (22045585) |
| Roles Classification |
|---|
| Chemical Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yersiniabactin (CHEBI:29707) has role bacterial metabolite (CHEBI:76969) |
| yersiniabactin (CHEBI:29707) has role siderophore (CHEBI:26672) |
| yersiniabactin (CHEBI:29707) is a monocarboxylic acid (CHEBI:25384) |
| yersiniabactin (CHEBI:29707) is a phenols (CHEBI:33853) |
| yersiniabactin (CHEBI:29707) is a secondary alcohol (CHEBI:35681) |
| yersiniabactin (CHEBI:29707) is a thiazolidines (CHEBI:35622) |
| yersiniabactin (CHEBI:29707) is conjugate acid of yersiniabactin(1−) (CHEBI:149525) |
| Incoming Relation(s) |
| yersiniabactin(1−) (CHEBI:149525) is conjugate base of yersiniabactin (CHEBI:29707) |
| IUPAC Name |
|---|
| (4S)-2-[(1S)-1-hydroxy-1-{(4R)-2-[(4R)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]-1,3-thiazolidin-4-yl}-2-methylpropan-2-yl]-4-methyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| Ybt | ChEBI |
| yersiniabactin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00029246 | KNApSAcK |
| C12038 | KEGG COMPOUND |
| CPD-9991 | MetaCyc |
| O34 | PDBeChem |
| Yersiniabactin | Wikipedia |
| Citations |
|---|