EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H35NO13 |
| Net Charge | 0 |
| Average Mass | 497.494 |
| Monoisotopic Mass | 497.21084 |
| SMILES | OCC1=C[C@H](N[C@H]2C[C@H](CO)[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H35NO13/c22-3-6-1-8(12(26)15(29)11(6)25)21-9-2-7(4-23)19(17(31)13(9)27)34-20-18(32)16(30)14(28)10(5-24)33-20/h1,7-32H,2-5H2/t7-,8+,9+,10-,11-,12+,13+,14-,15+,16+,17-,18-,19-,20+/m1/s1 |
| InChIKey | JARYYMUOCXVXNK-CSLFJTBJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces hygroscopicus (ncbitaxon:1912) | - | PubMed (5549382) | |
| Streptomyces hygroscopicus subsp. limoneus (ncbitaxon:264445) | - | PubMed (22961651) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.2.1.28 (alpha,alpha-trehalase) inhibitor An EC 2.4.1.* (hexosyltransferase) inhibitor that interferes with the action of α,α-trehalase (EC 2.4.1.28). EC 2.4.1.231 [alpha,alpha-trehalose phosphorylase (configuration-retaining)] inhibitor An EC 2.4.1.* (hexosyltransferase) inhibitor that interferes with the action of α,α-trehalose phosphorylase (configuration-retaining) (EC 2.4.1.231). antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. EC 2.4.1.64 (alpha,alpha-trehalose phosphorylase) inhibitor An EC 2.4.1.* (hexosyltransferase) inhibitor that interferes with the action of α,α-trehalose phosphorylase (EC 2.4.1.64). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| validamycin A (CHEBI:29703) has role antifungal agrochemical (CHEBI:86328) |
| validamycin A (CHEBI:29703) has role EC 2.4.1.231 [α,α-trehalose phosphorylase (configuration-retaining)] inhibitor (CHEBI:83757) |
| validamycin A (CHEBI:29703) has role EC 2.4.1.64 (α,α-trehalose phosphorylase) inhibitor (CHEBI:83760) |
| validamycin A (CHEBI:29703) has role EC 3.2.1.28 (α,α-trehalase) inhibitor (CHEBI:83762) |
| validamycin A (CHEBI:29703) is a antibiotic fungicide (CHEBI:87114) |
| validamycin A (CHEBI:29703) is a polyol (CHEBI:26191) |
| validamycin A (CHEBI:29703) is a secondary amino compound (CHEBI:50995) |
| validamycin A (CHEBI:29703) is a validamycins (CHEBI:83745) |
| validamycin A (CHEBI:29703) is conjugate base of validamycin A(1+) (CHEBI:90869) |
| Incoming Relation(s) |
| validamycin A(1+) (CHEBI:90869) is conjugate acid of validamycin A (CHEBI:29703) |
| IUPAC Name |
|---|
| (1R,2R,3S,4S,6R)-2,3-dihydroxy-6-(hydroxymethyl)-4-{[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino}cyclohexyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Validamycin | KEGG COMPOUND |
| 1,5,6-trideoxy-4-O-β-D-glucopyranosyl-5-(hydroxymethyl)-1-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)-2-cyclohexen-1-yl]amino]-D-chiro-inositol | Alan Wood's Pesticides |
| D-1,5,6-trideoxy-3-O-β-D-glucopyranosyl-5-(hydroxymethyl)-1-((4,5,6-trihydroxy-3-(hydroxymethyl)-2-cyclohexen-1-yl)amino)-D-chiroinositol | ChemIDplus |
| T-7545-A | ChemIDplus |
| 1L-(1,3,4/2,6)-2,3-dihydroxy-6-hydroxymethyl-4-((1S,4R,5S,6S)-4,5,6-trihydroxy-3-hydroxymethylcyclohex-2-enylamino)cyclohexyl β-D-glucopyranoside | ChemIDplus |
| (1S-(1α,4α,5β,6α))-1,5,6-trideoxy-4-O-β-D-glucopyranosyl-5-(hydroxymethyl)-1-((4,5,6-trihydroxy-3-(hydroxymethyl)-2-cyclohexen-1-yl)amino)-D-chiro-inositol | ChemIDplus |
| Brand Names | Source |
|---|---|
| Valimon | ChemIDplus |
| Validacin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C12112 | KEGG COMPOUND |
| C00018797 | KNApSAcK |
| validamycin | Alan Wood's Pesticides |
| Validamycin | Wikipedia |
| VALIDAMYCIN-A | MetaCyc |
| HMDB0036592 | HMDB |
| 677 | BPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5319831 | Reaxys |
| CAS:37248-47-8 | KEGG COMPOUND |
| CAS:37248-47-8 | ChemIDplus |
| Citations |
|---|