EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C66H87N13O13 |
| Net Charge | 0 |
| Average Mass | 1270.500 |
| Monoisotopic Mass | 1269.65463 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCN)NC(=O)[C@H](C(C)C)NC(=O)[C@]([H])(Cc1ccc(O)cc1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC2=O |
| InChI | InChI=1S/C66H87N13O13/c1-38(2)32-47-59(85)77-52(36-42-20-12-7-13-21-42)66(92)79-31-15-23-53(79)64(90)76-49(34-41-18-10-6-11-19-41)61(87)74-48(33-40-16-8-5-9-17-40)60(86)75-51(37-55(69)82)62(88)70-46(28-29-54(68)81)58(84)73-50(35-43-24-26-44(80)27-25-43)63(89)78-56(39(3)4)65(91)71-45(22-14-30-67)57(83)72-47/h5-13,16-21,24-27,38-39,45-53,56,80H,14-15,22-23,28-37,67H2,1-4H3,(H2,68,81)(H2,69,82)(H,70,88)(H,71,91)(H,72,83)(H,73,84)(H,74,87)(H,75,86)(H,76,90)(H,77,85)(H,78,89)/t45-,46-,47-,48+,49-,50-,51-,52+,53-,56-/m0/s1 |
| InChIKey | GSXRBRIWJGAPDU-BBVRJQLQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brevibacillus brevis (ncbitaxon:1393) | - | PubMed (4320358) | Strain: ATCC 8185 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tyrocidine A (CHEBI:29701) has role antibacterial agent (CHEBI:33282) |
| tyrocidine A (CHEBI:29701) has role bacterial metabolite (CHEBI:76969) |
| tyrocidine A (CHEBI:29701) is a homodetic cyclic peptide (CHEBI:24613) |
| tyrocidine A (CHEBI:29701) is a macrocycle (CHEBI:51026) |
| tyrocidine A (CHEBI:29701) is a peptide antibiotic (CHEBI:25903) |
| Incoming Relation(s) |
| tyrocidine (CHEBI:71947) has part tyrocidine A (CHEBI:29701) |
| IUPAC Name |
|---|
| cyclo(L-asparaginyl-L-glutaminyl-L-tyrosyl-L-valyl-L-ornithyl-L-leucyl-D-phenylalanyl-L-prolyl-L-phenylalanyl-D-phenylalanyl) |
| Synonyms | Source |
|---|---|
| cyclo-(D-Phe-Pro-Phe-D-Phe-Asn-Gln-Tyr-Val-Orn-Leu) | ChEBI |
| cyclo-(D-PheProPhe-D-PheAsnGlnTyrValOrnLeu) | ChEBI |
| TrcA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C12041 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:505927 | Reaxys |
| CAS:8011-61-8 | KEGG COMPOUND |
| Citations |
|---|