EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H4O3S2 |
| Net Charge | 0 |
| Average Mass | 212.251 |
| Monoisotopic Mass | 211.96019 |
| SMILES | O=c1osc2c(=S)cccc(O)c12 |
| InChI | InChI=1S/C8H4O3S2/c9-4-2-1-3-5(12)7-6(4)8(10)11-13-7/h1-3,9H |
| InChIKey | DQGOJKVIMNNGAH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas sp. (ncbitaxon:306) | - | PubMed (6511658) | Strain: CB-104 |
| Roseobacter sp. (ncbitaxon:1907202) | - | PubMed (16269767) | Strain: 27-4 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiotropocin (CHEBI:29694) has role antibacterial agent (CHEBI:33282) |
| thiotropocin (CHEBI:29694) has role bacterial metabolite (CHEBI:76969) |
| thiotropocin (CHEBI:29694) has role marine metabolite (CHEBI:76507) |
| thiotropocin (CHEBI:29694) is a organic heterobicyclic compound (CHEBI:27171) |
| thiotropocin (CHEBI:29694) is a organic hydroxy compound (CHEBI:33822) |
| thiotropocin (CHEBI:29694) is a organosulfur heterocyclic compound (CHEBI:38106) |
| thiotropocin (CHEBI:29694) is a thiocarbonyl compound (CHEBI:50492) |
| thiotropocin (CHEBI:29694) is a thionoester (CHEBI:51278) |
| thiotropocin (CHEBI:29694) is tautomer of tropodithietic acid (CHEBI:156455) |
| Incoming Relation(s) |
| tropodithietic acid (CHEBI:156455) is tautomer of thiotropocin (CHEBI:29694) |
| IUPAC Name |
|---|
| 4-hydroxy-8-sulfanylidenecyclohepta[c][1,2]oxathiol-3(8H)-one |
| Synonyms | Source |
|---|---|
| 4-hydroxy-8-sulfanylidene-3H,8H-cyclohepta[c][1,2]oxathiol-3-one | IUPAC |
| 4-hydroxy-8-thioxo-cyclohepta[c][1,2]oxathiol-3(8H)-one | ChEBI |
| thiotropocin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4415507 | Reaxys |
| CAS:89550-93-6 | ChemIDplus |
| Citations |
|---|