EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C72H85N19O18S5 |
| Net Charge | 0 |
| Average Mass | 1664.922 |
| Monoisotopic Mass | 1663.49235 |
| SMILES | [H][C@]12N=C(c3nc(C(=O)NC(=C)C(=O)NC(=C)C(N)=O)cs3)CC[C@@]13NC(=O)[C@H](C)NC(=O)C(=C)NC(=O)[C@H](C)NC(=O)[C@H]([C@@H](C)CC)N[C@@H]1C=Cc4c([C@H](C)O)cc(nc4[C@H]1O)C(=O)O[C@H](C)[C@H](NC(=O)c1csc(n1)[C@H]([C@](C)(O)[C@@H](C)O)NC(=O)[C@H]1CSC(=N1)/C(=C/C)NC(=O)[C@H]([C@@H](C)O)NC(=O)c1csc3n1)c1nc2cs1 |
| InChI | InChI=1S/C72H85N19O18S5/c1-14-26(3)47-63(105)78-30(7)57(99)75-28(5)56(98)76-31(8)58(100)91-72-19-18-40(66-85-43(22-111-66)59(101)77-29(6)55(97)74-27(4)54(73)96)81-52(72)42-21-112-67(83-42)49(34(11)109-69(107)41-20-37(32(9)92)36-16-17-39(79-47)51(95)50(36)80-41)89-60(102)44-24-113-68(86-44)53(71(13,108)35(12)94)90-62(104)45-23-110-65(84-45)38(15-2)82-64(106)48(33(10)93)88-61(103)46-25-114-70(72)87-46/h15-17,20-22,24-26,30-35,39,45,47-49,51-53,79,92-95,108H,4-6,14,18-19,23H2,1-3,7-13H3,(H2,73,96)(H,74,97)(H,75,99)(H,76,98)(H,77,101)(H,78,105)(H,82,106)(H,88,103)(H,89,102)(H,90,104)(H,91,100)/b38-15-/t26-,30-,31-,32-,33+,34+,35+,39+,45+,47-,48-,49-,51-,52+,53+,71+,72+/m0/s1 |
| InChIKey | NSFFHOGKXHRQEW-AIHSUZKVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. antibacterial drug A drug used to treat or prevent bacterial infections. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiostrepton (CHEBI:29693) has role antibacterial drug (CHEBI:36047) |
| thiostrepton (CHEBI:29693) has role antineoplastic agent (CHEBI:35610) |
| thiostrepton (CHEBI:29693) has role apoptosis inducer (CHEBI:68495) |
| thiostrepton (CHEBI:29693) has role ferroptosis inducer (CHEBI:173085) |
| thiostrepton (CHEBI:29693) has role metabolite (CHEBI:25212) |
| thiostrepton (CHEBI:29693) has role protein synthesis inhibitor (CHEBI:48001) |
| thiostrepton (CHEBI:29693) is a heterodetic cyclic peptide (CHEBI:24533) |
| Synonyms | Source |
|---|---|
| bryamycin | ChEBI |
| gargon | ChEBI |
| thiactin | ChEBI |
| Thiostrepton | KEGG COMPOUND |
| thiostrepton A | ChEBI |
| Citations |
|---|