EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:29693 - thiostrepton
| Formula | C72H85N19O18S5 |
| Net Charge | 0 |
| Average Mass | 1664.922 |
| Monoisotopic Mass | 1663.49235 |
| SMILES | [H][C@]12N=C(c3nc(C(=O)NC(=C)C(=O)NC(=C)C(N)=O)cs3)CC[C@@]13NC(=O)[C@H](C)NC(=O)C(=C)NC(=O)[C@H](C)NC(=O)[C@H]([C@@H](C)CC)N[C@@H]1C=Cc4c([C@H](C)O)cc(nc4[C@H]1O)C(=O)O[C@H](C)[C@H](NC(=O)c1csc(n1)[C@H]([C@](C)(O)[C@@H](C)O)NC(=O)[C@H]1CSC(=N1)/C(=C/C)NC(=O)[C@H]([C@@H](C)O)NC(=O)c1csc3n1)c1nc2cs1 |
| InChI | InChI=1S/C72H85N19O18S5/c1-14-26(3)47-63(105)78-30(7)57(99)75-28(5)56(98)76-31(8)58(100)91-72-19-18-40(66-85-43(22-111-66)59(101)77-29(6)55(97)74-27(4)54(73)96)81-52(72)42-21-112-67(83-42)49(34(11)109-69(107)41-20-37(32(9)92)36-16-17-39(79-47)51(95)50(36)80-41)89-60(102)44-24-113-68(86-44)53(71(13,108)35(12)94)90-62(104)45-23-110-65(84-45)38(15-2)82-64(106)48(33(10)93)88-61(103)46-25-114-70(72)87-46/h15-17,20-22,24-26,30-35,39,45,47-49,51-53,79,92-95,108H,4-6,14,18-19,23H2,1-3,7-13H3,(H2,73,96)(H,74,97)(H,75,99)(H,76,98)(H,77,101)(H,78,105)(H,82,106)(H,88,103)(H,89,102)(H,90,104)(H,91,100)/b38-15-/t26-,30-,31-,32-,33+,34+,35+,39+,45+,47-,48-,49-,51-,52+,53+,71+,72+/m0/s1 |
| InChIKey | NSFFHOGKXHRQEW-AIHSUZKVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antibacterial drug A drug used to treat or prevent bacterial infections. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiostrepton (CHEBI:29693) has role antibacterial drug (CHEBI:36047) |
| thiostrepton (CHEBI:29693) has role antineoplastic agent (CHEBI:35610) |
| thiostrepton (CHEBI:29693) has role apoptosis inducer (CHEBI:68495) |
| thiostrepton (CHEBI:29693) has role ferroptosis inducer (CHEBI:173085) |
| thiostrepton (CHEBI:29693) has role metabolite (CHEBI:25212) |
| thiostrepton (CHEBI:29693) has role protein synthesis inhibitor (CHEBI:48001) |
| thiostrepton (CHEBI:29693) is a heterodetic cyclic peptide (CHEBI:24533) |
| Synonyms | Source |
|---|---|
| bryamycin | ChEBI |
| gargon | ChEBI |
| thiactin | ChEBI |
| Thiostrepton | KEGG COMPOUND |
| thiostrepton A | ChEBI |
| Citations |
|---|