EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N4O5S2 |
| Net Charge | +1 |
| Average Mass | 461.545 |
| Monoisotopic Mass | 461.09479 |
| SMILES | [H][C@]12[C@@H](C)C(Sc3nc(-c4cc[n+](CC(N)=O)cc4)cs3)=C(C(=O)O)N1C(=O)[C@]2([H])[C@@H](C)O |
| InChI | InChI=1S/C20H20N4O5S2/c1-9-15-14(10(2)25)18(27)24(15)16(19(28)29)17(9)31-20-22-12(8-30-20)11-3-5-23(6-4-11)7-13(21)26/h3-6,8-10,14-15,25H,7H2,1-2H3,(H2-,21,26,28,29)/p+1/t9-,10-,14-,15-/m1/s1 |
| InChIKey | RRTBMNWYYYTAEH-XEQNPHJVSA-O |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SM-17466 (CHEBI:29675) is a carbapenems (CHEBI:46633) |
| Synonym | Source |
|---|---|
| SM-17466 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C12018 | KEGG COMPOUND |