EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H47NO12 |
| Net Charge | 0 |
| Average Mass | 697.778 |
| Monoisotopic Mass | 697.30983 |
| SMILES | CO[C@H]1/C=C/O[C@@]2(C)Oc3c(C)c(O)c4c(O)c(cc(O)c4c3C2=O)NC(=O)/C(C)=C\C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C37H47NO12/c1-16-11-10-12-17(2)36(46)38-23-15-24(40)26-27(32(23)44)31(43)21(6)34-28(26)35(45)37(8,50-34)48-14-13-25(47-9)18(3)33(49-22(7)39)20(5)30(42)19(4)29(16)41/h10-16,18-20,25,29-30,33,40-44H,1-9H3,(H,38,46)/b11-10+,14-13+,17-12-/t16-,18+,19+,20+,25-,29-,30+,33+,37-/m0/s1 |
| InChIKey | HJYYPODYNSCCOU-ODRIEIDWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Amycolatopsis mediterranei (ncbitaxon:33910) | - | PubMed (25256628) | Strain: OVA5-E7 |
| Roles Classification |
|---|
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rifamycin SV (CHEBI:29673) has role antimicrobial agent (CHEBI:33281) |
| rifamycin SV (CHEBI:29673) has role antispasmodic drug (CHEBI:53784) |
| rifamycin SV (CHEBI:29673) has role antitubercular agent (CHEBI:33231) |
| rifamycin SV (CHEBI:29673) has role bacterial metabolite (CHEBI:76969) |
| rifamycin SV (CHEBI:29673) has role ophthalmology drug (CHEBI:66981) |
| rifamycin SV (CHEBI:29673) is a acetate ester (CHEBI:47622) |
| rifamycin SV (CHEBI:29673) is a cyclic ketal (CHEBI:59779) |
| rifamycin SV (CHEBI:29673) is a lactam (CHEBI:24995) |
| rifamycin SV (CHEBI:29673) is a macrocycle (CHEBI:51026) |
| rifamycin SV (CHEBI:29673) is a organic heterotetracyclic compound (CHEBI:38163) |
| rifamycin SV (CHEBI:29673) is a polyphenol (CHEBI:26195) |
| rifamycin SV (CHEBI:29673) is a rifamycins (CHEBI:26580) |
| rifamycin SV (CHEBI:29673) is conjugate acid of rifamycin SV(1−) (CHEBI:84571) |
| Incoming Relation(s) |
| rifamycin SV hemiaminal (CHEBI:142732) has functional parent rifamycin SV (CHEBI:29673) |
| rifamycin SV(1−) (CHEBI:84571) is conjugate base of rifamycin SV (CHEBI:29673) |
| IUPAC Name |
|---|
| (2S,12Z,14E,16S,17S,18R,19R,20R,21S,22R,23S,24E)-5,6,9,17,19-pentahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-1,11-dioxo-1,2-dihydro-2,7-(epoxypentadeca[1,11,13]trienoimino)naphtho[2,1-b]furan-21-yl acetate |
| INNs | Source |
|---|---|
| rifamicina | ChemIDplus |
| rifamycin | KEGG DRUG |
| rifamycine | ChemIDplus |
| rifamycinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| M-14 | ChEMBL |
| Rifamicine sv | ChEMBL |
| rifamycin | ChEMBL |
| Rifamycin | KEGG COMPOUND |
| Rifamycin SV | KEGG COMPOUND |
| Rifocin | ChemIDplus |
| Citations |
|---|