EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H33NO12 |
| Net Charge | 0 |
| Average Mass | 659.644 |
| Monoisotopic Mass | 659.20028 |
| SMILES | CN[C@H]1[C@@H](O[C@@H]2/C3=C/C#C[C@H]4O[C@@]4([C@H]4COC(=O)O4)C#CC3=C[C@H]2OC(=O)c2c(O)ccc3c(C)cc(OC)cc23)O[C@H](C)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C35H33NO12/c1-16-12-19(42-4)14-22-20(16)8-9-23(37)27(22)32(40)45-24-13-18-10-11-35(26-15-43-34(41)46-26)25(48-35)7-5-6-21(18)31(24)47-33-28(36-3)30(39)29(38)17(2)44-33/h6,8-9,12-14,17,24-26,28-31,33,36-39H,15H2,1-4H3/b21-6+/t17-,24-,25-,26-,28-,29+,30-,31-,33-,35+/m1/s1 |
| InChIKey | QZGIWPZCWHMVQL-UIYAJPBUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neocarzinostatin chromophore (CHEBI:29655) has role antineoplastic agent (CHEBI:35610) |
| neocarzinostatin chromophore (CHEBI:29655) is a D-galactosaminide (CHEBI:20954) |
| neocarzinostatin chromophore (CHEBI:29655) is a cyclopentacyclononaoxirene (CHEBI:46830) |
| neocarzinostatin chromophore (CHEBI:29655) is a dioxolane (CHEBI:39430) |
| neocarzinostatin chromophore (CHEBI:29655) is a monosaccharide derivative (CHEBI:63367) |
| neocarzinostatin chromophore (CHEBI:29655) is a naphthoate ester (CHEBI:46831) |
| IUPAC Name |
|---|
| (1aS,5R,6R,6aE,9aR)-6-{[2,6-dideoxy-2-(methylamino)-α-D-galactopyranosyl]oxy}-1a-[(4R)-2-oxo-1,3-dioxolan-4-yl]-2,3,8,9-tetradehydro-1a,5,6,9a-tetrahydrocyclopenta[5,6]cyclonona[1,2-b]oxiren-5-yl 2-hydroxy-7-methoxy-5-methyl-1-naphthoate |
| Synonyms | Source |
|---|---|
| Ncs-chrom | ChemIDplus |
| Neocarzinostatin chromophore | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 4108 | DrugCentral |
| C12049 | KEGG COMPOUND |
| CHR | PDBeChem |
| Neocarzinostatin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4224827 | Reaxys |
| CAS:81604-85-5 | KEGG COMPOUND |
| CAS:81604-85-5 | ChemIDplus |
| Citations |
|---|