EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H43N8O17P3S |
| Net Charge | 0 |
| Average Mass | 900.691 |
| Monoisotopic Mass | 900.16797 |
| SMILES | CNc1ccccc1C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C29H43N8O17P3S/c1-29(2,23(40)26(41)33-9-8-19(38)32-10-11-58-28(42)16-6-4-5-7-17(16)31-3)13-51-57(48,49)54-56(46,47)50-12-18-22(53-55(43,44)45)21(39)27(52-18)37-15-36-20-24(30)34-14-35-25(20)37/h4-7,14-15,18,21-23,27,31,39-40H,8-13H2,1-3H3,(H,32,38)(H,33,41)(H,46,47)(H,48,49)(H2,30,34,35)(H2,43,44,45)/t18-,21-,22-,23+,27-/m1/s1 |
| InChIKey | DYCZFHXLKCLDQL-SXQYHYLKSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylanthraniloyl-CoA (CHEBI:30305) has functional parent N-methylanthranilic acid (CHEBI:16394) |
| N-methylanthraniloyl-CoA (CHEBI:30305) has functional parent coenzyme A (CHEBI:15346) |
| N-methylanthraniloyl-CoA (CHEBI:30305) is a aroyl-CoA (CHEBI:61940) |
| N-methylanthraniloyl-CoA (CHEBI:30305) is conjugate acid of N-methylanthraniloyl-CoA(4−) (CHEBI:58630) |
| Incoming Relation(s) |
| N-methylanthraniloyl-CoA(4−) (CHEBI:58630) is conjugate base of N-methylanthraniloyl-CoA (CHEBI:30305) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[3-hydroxy-2,2-dimethyl-4-({3-[(2-{[2-(methylamino)benzoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| N-Methylanthraniloyl-CoA | KEGG COMPOUND |
| N-methylanthraniloyl-coenzyme A | ChEBI |
| S-[2-(methylamino)benzoyl]-coenzyme A | ChEBI |
| N-methylanthranilyl-CoA | ChEBI |
| N-methylanthranilyl-coenzyme A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C12092 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11032524 | Reaxys |
| Citations |
|---|