EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13NO3 |
| Net Charge | 0 |
| Average Mass | 171.196 |
| Monoisotopic Mass | 171.08954 |
| SMILES | CCCC(=O)N[C@@H]1CCOC1=O |
| InChI | InChI=1S/C8H13NO3/c1-2-3-7(10)9-6-4-5-12-8(6)11/h6H,2-5H2,1H3,(H,9,10)/t6-/m1/s1 |
| InChIKey | VFFNZZXXTGXBOG-ZCFIWIBFSA-N |
| Roles Classification |
|---|
| Biological Role: | autoinducer A signalling molecule produced and used by bacteria participating in quorum sensing, that is, in cell-cell communication to coordinate community-wide regulation of processes such as biofilm formation, virulence, and bioluminescence in populations of bacteria. Such communication can occur both within and between different species of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-butyryl-L-homoserine lactone (CHEBI:29643) is a N-acyl-L-homoserine lactone (CHEBI:55474) |
| IUPAC Name |
|---|
| N-[(3R)-2-oxotetrahydrofuran-3-yl]butanamide |
| Synonyms | Source |
|---|---|
| N-Butyrylhomoserine lactone | LIPID MAPS |
| N-Butyryl-L-homoserine lactone | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| N-butanoyl-L-homoserine lactone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C11837 | KEGG COMPOUND |
| LMFA08030002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8833344 | Beilstein |