EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13NO4 |
| Net Charge | 0 |
| Average Mass | 187.195 |
| Monoisotopic Mass | 187.08446 |
| SMILES | [H][C@@](C)(O)CC(=O)NC1CCOC1=O |
| InChI | InChI=1S/C8H13NO4/c1-5(10)4-7(11)9-6-2-3-13-8(6)12/h5-6,10H,2-4H2,1H3,(H,9,11)/t5-,6?/m0/s1 |
| InChIKey | FIXDIFPJOFIIEC-ZBHICJROSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(3-(S)-Hydroxybutyryl)homoserine lactone (CHEBI:29637) is a N-acyl-amino acid (CHEBI:51569) |
| Synonym | Source |
|---|---|
| N-(3-(S)-Hydroxybutyryl)homoserine lactone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11842 | KEGG COMPOUND |