EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H43NO7 |
| Net Charge | 0 |
| Average Mass | 469.619 |
| Monoisotopic Mass | 469.30395 |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2O)[C@@H](C)C[C@@H](C)C(=O)/C=C/[C@]1(C)O |
| InChI | InChI=1S/C25H43NO7/c1-9-20-25(6,30)11-10-19(27)14(2)12-15(3)22(17(5)23(29)32-20)33-24-21(28)18(26(7)8)13-16(4)31-24/h10-11,14-18,20-22,24,28,30H,9,12-13H2,1-8H3/b11-10+/t14-,15+,16-,17-,18+,20-,21-,22+,24+,25+/m1/s1 |
| InChIKey | HUKYPYXOBINMND-HYUJHOPRSA-N |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methymycin (CHEBI:29630) has role bacterial metabolite (CHEBI:76969) |
| methymycin (CHEBI:29630) is a enone (CHEBI:51689) |
| methymycin (CHEBI:29630) is a macrolide antibiotic (CHEBI:25105) |
| methymycin (CHEBI:29630) is a monosaccharide derivative (CHEBI:63367) |
| methymycin (CHEBI:29630) is conjugate base of methymycin(1+) (CHEBI:77352) |
| Incoming Relation(s) |
| methymycin(1+) (CHEBI:77352) is conjugate acid of methymycin (CHEBI:29630) |
| IUPAC Name |
|---|
| (3R,4S,5S,7R,9E,11S,12R)-12-ethyl-11-hydroxy-3,5,7,11-tetramethyl-2,8-dioxooxacyclododec-9-en-4-yl 3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranoside |
| Manual Xrefs | Databases |
|---|---|
| C11996 | KEGG COMPOUND |
| CPD-13832 | MetaCyc |
| EP1090125 | Patent |
| LMPK04000037 | LIPID MAPS |
| MT9 | PDBeChem |
| US2003073824 | Patent |
| WO0000620 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:61348 | Reaxys |
| CAS:497-72-3 | ChemIDplus |
| CAS:497-72-3 | KEGG COMPOUND |
| Citations |
|---|