EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23N3O7S2 |
| Net Charge | 0 |
| Average Mass | 493.563 |
| Monoisotopic Mass | 493.09774 |
| SMILES | CC(O)C1C(=O)N2C(C(=O)O)=C(SC3NC(C(=O)Nc4cccc(C(=O)O)c4)CS3)C(C)C12 |
| InChI | InChI=1S/C21H23N3O7S2/c1-8-14-13(9(2)25)18(27)24(14)15(20(30)31)16(8)33-21-23-12(7-32-21)17(26)22-11-5-3-4-10(6-11)19(28)29/h3-6,8-9,12-14,21,23,25H,7H2,1-2H3,(H,22,26)(H,28,29)(H,30,31) |
| InChIKey | WQQHQJCEAFGLEA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MK826 (CHEBI:29621) is a carbapenems (CHEBI:46633) |
| Synonym | Source |
|---|---|
| MK826 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C12017 | KEGG COMPOUND |