EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2962 - kresoxim-methyl
| Formula | C18H19NO4 |
| Net Charge | 0 |
| Average Mass | 313.353 |
| Monoisotopic Mass | 313.13141 |
| SMILES | CO/N=C(/C(=O)OC)c1ccccc1COc1ccccc1C |
| InChI | InChI=1S/C18H19NO4/c1-13-8-4-7-11-16(13)23-12-14-9-5-6-10-15(14)17(19-22-3)18(20)21-2/h4-11H,12H2,1-3H3/b19-17+ |
| InChIKey | ZOTBXTZVPHCKPN-HTXNQAPBSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kresoxim-methyl (CHEBI:2962) has role antifungal agrochemical (CHEBI:86328) |
| kresoxim-methyl (CHEBI:2962) has role environmental contaminant (CHEBI:78298) |
| kresoxim-methyl (CHEBI:2962) has role mitochondrial cytochrome-bc1 complex inhibitor (CHEBI:38499) |
| kresoxim-methyl (CHEBI:2962) has role xenobiotic (CHEBI:35703) |
| kresoxim-methyl (CHEBI:2962) is a aromatic ether (CHEBI:35618) |
| kresoxim-methyl (CHEBI:2962) is a methoxyiminoacetate strobilurin antifungal agent (CHEBI:86488) |
| kresoxim-methyl (CHEBI:2962) is a methyl ester (CHEBI:25248) |
| kresoxim-methyl (CHEBI:2962) is a oxime O-ether (CHEBI:36816) |
| IUPAC Name |
|---|
| methyl (2E)-(methoxyimino){2-[(2-methylphenoxy)methyl]phenyl}acetate |
| Synonyms | Source |
|---|---|
| BAS 490 F | KEGG COMPOUND |
| Methyl (E)-alpha-(methoxyimino)-2-((2-methylphenoxy)methyl)benzeneacetate | ChemIDplus |
| methyl (αE)-α-(methoxyimino)-2-[(2-methylphenoxy)methyl]benzeneacetate | NIST Chemistry WebBook |
| methyl (E)-methoxyimino[α-(o-tolyloxy)-o-tolyl]acetate | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| C11017 | KEGG COMPOUND |
| kresoxim-methyl | Alan Wood's Pesticides |
| 414 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8330581 | Reaxys |
| CAS:143390-89-0 | KEGG COMPOUND |
| CAS:143390-89-0 | ChemIDplus |
| CAS:143390-89-0 | NIST Chemistry WebBook |
| Citations |
|---|