EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H44O10 |
| Net Charge | 0 |
| Average Mass | 516.628 |
| Monoisotopic Mass | 516.29345 |
| SMILES | C[C@@H]1[C@@H](O)[C@@H](C)C[C@@]2(CO2)C(=O)[C@H](C)[C@@H](O)[C@@H](C)[C@@H](C)OC(=O)[C@H](C)[C@H]1O[C@H]1C[C@H](O)[C@@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C26H44O10/c1-11-9-26(10-33-26)24(31)14(4)21(29)12(2)16(6)35-25(32)15(5)23(13(3)20(11)28)36-19-8-18(27)22(30)17(7)34-19/h11-23,27-30H,8-10H2,1-7H3/t11-,12-,13+,14+,15+,16+,17-,18-,19-,20-,21-,22-,23-,26+/m0/s1 |
| InChIKey | SBBLTTCUMKGRJI-GYHYDPCPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-(α-L-olivosyl)oleandolide (CHEBI:29614) has functional parent oleandolide (CHEBI:29658) |
| 3-O-(α-L-olivosyl)oleandolide (CHEBI:29614) has role metabolite (CHEBI:25212) |
| 3-O-(α-L-olivosyl)oleandolide (CHEBI:29614) is a glycoside (CHEBI:24400) |
| 3-O-(α-L-olivosyl)oleandolide (CHEBI:29614) is a macrolide (CHEBI:25106) |
| 3-O-(α-L-olivosyl)oleandolide (CHEBI:29614) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| (3R,5R,6S,7R,8R,11R,12S,13R,14S,15S)-6,14-dihydroxy-5,7,8,11,13,15-hexamethyl-4,10-dioxo-1,9-dioxaspiro[2.13]hexadec-12-yl 2,6-dideoxy-α-L-arabino-hexopyranoside |
| Synonym | Source |
|---|---|
| L-Olivosyl-oleandolide | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| L-olivosyl-oleandolide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C11991 | KEGG COMPOUND |
| LMPK04000032 | LIPID MAPS |
| Citations |
|---|