EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O4 |
| Net Charge | 0 |
| Average Mass | 316.397 |
| Monoisotopic Mass | 316.16746 |
| SMILES | [H][C@]12CC[C@]3([H])[C@](CC1=C)(C2)[C@@H](C(=O)O)[C@@]1([H])[C@@]32CCC[C@@]1(C)C(=O)O2 |
| InChI | InChI=1S/C19H24O4/c1-10-8-18-9-11(10)4-5-12(18)19-7-3-6-17(2,16(22)23-19)14(19)13(18)15(20)21/h11-14H,1,3-9H2,2H3,(H,20,21)/t11-,12-,13-,14-,17-,18+,19-/m1/s1 |
| InChIKey | MHVYWTXXZIFXDT-YGNOGLJPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) | From MetaboLights |
| Gibberella fujikuroi (ncbitaxon:5127) | - | PubMed (24232845) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A9 (CHEBI:29605) has role mouse metabolite (CHEBI:75771) |
| gibberellin A9 (CHEBI:29605) has role plant metabolite (CHEBI:76924) |
| gibberellin A9 (CHEBI:29605) is a C19-gibberellin (CHEBI:20858) |
| gibberellin A9 (CHEBI:29605) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| gibberellin A9 (CHEBI:29605) is a lactone (CHEBI:25000) |
| gibberellin A9 (CHEBI:29605) is conjugate acid of gibberellin A9(1−) (CHEBI:73255) |
| Incoming Relation(s) |
| 2,3-didehydro-gibberellin A9 (CHEBI:29467) has functional parent gibberellin A9 (CHEBI:29605) |
| 3β-chloro-gibberellin A9 (CHEBI:142120) has functional parent gibberellin A9 (CHEBI:29605) |
| 3β-fluoro-gibberellin A9 (CHEBI:142122) has functional parent gibberellin A9 (CHEBI:29605) |
| gibberellin A9 methyl ester (CHEBI:73256) has functional parent gibberellin A9 (CHEBI:29605) |
| gibberellin A9(1−) (CHEBI:73255) is conjugate base of gibberellin A9 (CHEBI:29605) |
| IUPAC Names |
|---|
| (1R,2R,5R,8R,9S,10R,11R)-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid |
| 1β-methyl-8-methylidene-13-oxo-4a,1α-epoxymethano-4aα,4bβ-gibbane-10β-carboxylic acid |
| Synonyms | Source |
|---|---|
| GA9 | ChEBI |
| Gibberellin A9 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000009 | KNApSAcK |
| C11863 | KEGG COMPOUND |
| CPD1F-134 | MetaCyc |
| FDB013653 | FooDB |
| HMDB0303451 | HMDB |
| LMPR0104170020 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4267721 | Reaxys |
| CAS:427-77-0 | ChemIDplus |
| Citations |
|---|