EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O6 |
| Net Charge | 0 |
| Average Mass | 346.379 |
| Monoisotopic Mass | 346.14164 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]23C[C@@H]2O[C@@H]2[C@@]1(C)C(=O)O3 |
| InChI | InChI=1S/C19H22O6/c1-8-5-17-7-18(8,23)4-3-10(17)19-6-9-13(24-9)16(2,15(22)25-19)12(19)11(17)14(20)21/h9-13,23H,1,3-7H2,2H3,(H,20,21)/t9-,10+,11+,12+,13-,16-,17-,18-,19+/m0/s1 |
| InChIKey | XNBWKKYPKJHUKD-UQJCXHNCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phaseolus coccineus (ncbitaxon:3886) | - | PubMed (24232845) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A6 (CHEBI:29602) is a C19-gibberellin (CHEBI:20858) |
| gibberellin A6 (CHEBI:29602) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| gibberellin A6 (CHEBI:29602) is a lactone (CHEBI:25000) |
| IUPAC Names |
|---|
| (1R,2R,5S,8S,9S,10R,11S,12R,14S)-5-hydroxy-11-methyl-6-methylidene-17-oxo-13,16-dioxahexacyclo[9.4.2.15,8.01,10.02,8.012,14]octadecane-9-carboxylic acid |
| 2β,3β-epoxy-7α-hydroxy-1β-methyl-8-methylidene-13-oxo-4a,1α-epoxymethano-4aα,4bβ-gibbane-10β-carboxylic acid |
| Synonyms | Source |
|---|---|
| ent-2α,3α-epoxy-13-hydroxy-20-norgibberell-16-en-19-oic acid 19,10-lactone | ChEBI |
| GA6 | ChEBI |
| Gibberellin A6 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000006 | KNApSAcK |
| C11856 | KEGG COMPOUND |
| LMPR0104170013 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4335073 | Reaxys |
| CAS:19147-78-5 | KEGG COMPOUND |
| Citations |
|---|