EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17N5O8S2 |
| Net Charge | 0 |
| Average Mass | 435.440 |
| Monoisotopic Mass | 435.05185 |
| SMILES | C[C@H]1[C@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c2csc([NH3+])n2)C(=O)N1S(=O)(=O)[O-] |
| InChI | InChI=1S/C13H17N5O8S2/c1-5-7(10(20)18(5)28(23,24)25)16-9(19)8(6-4-27-12(14)15-6)17-26-13(2,3)11(21)22/h4-5,7H,1-3H3,(H2,14,15)(H,16,19)(H,21,22)(H,23,24,25)/b17-8-/t5-,7-/m0/s1 |
| InChIKey | WZPBZJONDBGPKJ-VEHQQRBSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. EC 2.4.1.129 (peptidoglycan glycosyltransferase) inhibitor An EC 2.4.1.* (hexosyltransferase) inhibitor that interferes with the action of peptidoglycan glycosyltransferase (EC 2.4.1.129). drug allergen Any drug which causes the onset of an allergic reaction. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aztreonam (CHEBI:161680) has role antibacterial drug (CHEBI:36047) |
| aztreonam (CHEBI:161680) has role drug allergen (CHEBI:88188) |
| aztreonam (CHEBI:161680) has role EC 2.4.1.129 (peptidoglycan glycosyltransferase) inhibitor (CHEBI:50696) |
| aztreonam (CHEBI:161680) is a monobactam (CHEBI:50695) |
| aztreonam (CHEBI:161680) is a β-lactam antibiotic allergen (CHEBI:88225) |
| Incoming Relation(s) |
| aztreonyl-L-lysine (CHEBI:139368) has functional parent aztreonam (CHEBI:161680) |
| aztreonyl group (CHEBI:60429) is substituent group from aztreonam (CHEBI:161680) |
| IUPAC Name |
|---|
| (2S,3S)-3-{(2Z)-2-(2-ammonio-1,3-thiazol-4-yl)-2-[(2-carboxypropan-2-yloxy)imino]acetamido}-2-methyl-4-oxoazetidine-1-sulfonate |
| INNs | Source |
|---|---|
| aztreonam | ChEBI |
| aztréonam | ChEBI |
| aztreonamum | ChemIDplus |
| Synonyms | Source |
|---|---|
| AZT | ChEBI |
| (Z,)-2-((((2-Amino-4-thiazolyl)(((2S,3S,)-2-methyl-4-oxo-1-sulfo-3-azetidinyl)carbamoyl)methylene)amino)oxy)-2-methylpropionic acid | ChemIDplus |
| Brand Names | Source |
|---|---|
| Azactam | DrugBank |
| Primbactam | DrugBank |
| Citations |
|---|