EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O5 |
| Net Charge | 0 |
| Average Mass | 332.396 |
| Monoisotopic Mass | 332.16237 |
| SMILES | [H][C@]12CC[C@]3([H])[C@](CC1=C)(C2)[C@@H](C(=O)O)[C@@]1([H])[C@@]32C[C@H](O)C[C@@]1(C)C(=O)O2 |
| InChI | InChI=1S/C19H24O5/c1-9-5-18-6-10(9)3-4-12(18)19-8-11(20)7-17(2,16(23)24-19)14(19)13(18)15(21)22/h10-14,20H,1,3-8H2,2H3,(H,21,22)/t10-,11-,12-,13-,14-,17-,18+,19-/m1/s1 |
| InChIKey | HHDWSDSMWJQURA-MHKXYFPYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A51 (CHEBI:29599) is a C19-gibberellin (CHEBI:20858) |
| gibberellin A51 (CHEBI:29599) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| gibberellin A51 (CHEBI:29599) is a lactone (CHEBI:25000) |
| Incoming Relation(s) |
| gibberellin A51-catabolite (CHEBI:29600) has functional parent gibberellin A51 (CHEBI:29599) |
| IUPAC Names |
|---|
| (1R,2R,5R,8R,9S,10R,11R,13R)-13-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid |
| 3β-hydroxy-1β-methyl-8-methylidene-13-oxo-4a,1α-epoxymethano-4aα,4bβ-gibbane-10β-carboxylic acid |
| Synonyms | Source |
|---|---|
| GA51 | ChEBI |
| Gibberellin A51 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000051 | KNApSAcK |
| C11865 | KEGG COMPOUND |
| LMPR0104170022 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4551965 | Beilstein |
| CAS:56978-14-4 | KEGG COMPOUND |